C25H21BrFNS2 — CID 10051615
16-[5-(2-fluoroethyl)thiophen-2-yl]-16-thiophen-2-yl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene bromide (PubChem CID 10051615) has the molecular formula C25H21BrFNS2 and a molecular weight of 498.49 g/mol. Its IUPAC name is 16-[5-(2-fluoroethyl)thiophen-2-yl]-16-thiophen-2-yl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene bromide.
| Compound Name | 16-[5-(2-fluoroethyl)thiophen-2-yl]-16-thiophen-2-yl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene bromide |
|---|---|
| PubChem CID | 10051615 |
| Molecular Formula | C25H21BrFNS2 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | 16-[5-(2-fluoroethyl)thiophen-2-yl]-16-thiophen-2-yl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene bromide |
| SMILES | FCCc1ccc(C2(c3cccs3)CC3c4ccccc4C2c2cccc[n+]23)s1.[Br-] |
| InChI | InChI=1S/C25H21FNS2.BrH/c26-13-12-17-10-11-23(29-17)25(22-9-5-15-28-22)16-21-18-6-1-2-7-19(18)24(25)20-8-3-4-14-27(20)21;/h1-11,14-15,21,24H,12-13,16H2;1H/q+1;/p-1 |
| InChIKey | CTXSJNGALDVWFP-UHFFFAOYSA-M |
| XLogP | 3.04 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|