C22H27N3O3S — CID 100516505
1-acetyl-N-(4-piperidin-1-ylphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide (PubChem CID 100516505) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 1-acetyl-N-(4-piperidin-1-ylphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide.
| Compound Name | 1-acetyl-N-(4-piperidin-1-ylphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 100516505 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-acetyl-N-(4-piperidin-1-ylphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide |
| SMILES | CC(=O)N1CCCc2cc(S(=O)(=O)Nc3ccc(N4CCCCC4)cc3)ccc21 |
| InChI | InChI=1S/C22H27N3O3S/c1-17(26)25-15-5-6-18-16-21(11-12-22(18)25)29(27,28)23-19-7-9-20(10-8-19)24-13-3-2-4-14-24/h7-12,16,23H,2-6,13-15H2,1H3 |
| InChIKey | AWJMXHGWQKGBSS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|