C26H18FN5O3S — CID 10051659
4-amino-3-(4-fluorophenyl)-5-(4-methoxyphenyl)-7-(4-nitrophenyl)pyrido[2,3-d]pyrimidine-2-thione (PubChem CID 10051659) has the molecular formula C26H18FN5O3S and a molecular weight of 499.53 g/mol. Its IUPAC name is 4-amino-3-(4-fluorophenyl)-5-(4-methoxyphenyl)-7-(4-nitrophenyl)pyrido[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-amino-3-(4-fluorophenyl)-5-(4-methoxyphenyl)-7-(4-nitrophenyl)pyrido[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 10051659 |
| Molecular Formula | C26H18FN5O3S |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 4-amino-3-(4-fluorophenyl)-5-(4-methoxyphenyl)-7-(4-nitrophenyl)pyrido[2,3-d]pyrimidine-2-thione |
| SMILES | COc1ccc(-c2cc(-c3ccc([N+](=O)[O-])cc3)nc3nc(=S)n(-c4ccc(F)cc4)c(N)c23)cc1 |
| InChI | InChI=1S/C26H18FN5O3S/c1-35-20-12-4-15(5-13-20)21-14-22(16-2-8-19(9-3-16)32(33)34)29-25-23(21)24(28)31(26(36)30-25)18-10-6-17(27)7-11-18/h2-14H,28H2,1H3 |
| InChIKey | HHTOHJMADVVJAZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|