C13H15N3O3S — CID 100516590
4-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]butanoic acid (PubChem CID 100516590) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 4-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]butanoic acid.
| Compound Name | 4-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 100516590 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSc1n[nH]c(COc2ccccc2)n1 |
| InChI | InChI=1S/C13H15N3O3S/c17-12(18)7-4-8-20-13-14-11(15-16-13)9-19-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,17,18)(H,14,15,16) |
| InChIKey | SVSAISBZBUVWOB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|