C26H30F2N4O4 — CID 10051704
(2,4-difluorophenyl)methyl (6S,9aS)-6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 10051704) has the molecular formula C26H30F2N4O4 and a molecular weight of 500.55 g/mol. Its IUPAC name is (2,4-difluorophenyl)methyl (6S,9aS)-6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | (2,4-difluorophenyl)methyl (6S,9aS)-6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 10051704 |
| Molecular Formula | C26H30F2N4O4 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (2,4-difluorophenyl)methyl (6S,9aS)-6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | NCCCC[C@H]1C(=O)N(Cc2ccccc2)C[C@@H]2N(C(=O)OCc3ccc(F)cc3F)CCC(=O)N21 |
| InChI | InChI=1S/C26H30F2N4O4/c27-20-10-9-19(21(28)14-20)17-36-26(35)31-13-11-24(33)32-22(8-4-5-12-29)25(34)30(16-23(31)32)15-18-6-2-1-3-7-18/h1-3,6-7,9-10,14,22-23H,4-5,8,11-13,15-17,29H2/t22-,23+/m0/s1 |
| InChIKey | JZVMZHOBPPWTJD-XZOQPEGZSA-N |
| XLogP | 3.00 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|