C23H25N3O4 — CID 100517831
N-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide (PubChem CID 100517831) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide.
| Compound Name | N-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide |
|---|---|
| PubChem CID | 100517831 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide |
| SMILES | CCOc1ccc(-c2noc(CNC(=O)COc3cccc4c3CCCC4)n2)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-2-28-18-12-10-17(11-13-18)23-25-22(30-26-23)14-24-21(27)15-29-20-9-5-7-16-6-3-4-8-19(16)20/h5,7,9-13H,2-4,6,8,14-15H2,1H3,(H,24,27) |
| InChIKey | UKJDBQDPDOEUOR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |