C21H25BrNO2+ — CID 10051803
(1S,8S)-10-bromo-16,16-diethoxy-15,15-dimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene (PubChem CID 10051803) has the molecular formula C21H25BrNO2+ and a molecular weight of 403.34 g/mol. Its IUPAC name is (1S,8S)-10-bromo-16,16-diethoxy-15,15-dimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene.
| Compound Name | (1S,8S)-10-bromo-16,16-diethoxy-15,15-dimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene |
|---|---|
| PubChem CID | 10051803 |
| Molecular Formula | C21H25BrNO2+ |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (1S,8S)-10-bromo-16,16-diethoxy-15,15-dimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene |
| SMILES | CCOC1(OCC)[C@H]2c3c(Br)cccc3[C@H]([n+]3ccccc32)C1(C)C |
| InChI | InChI=1S/C21H25BrNO2/c1-5-24-21(25-6-2)18-16-12-7-8-13-23(16)19(20(21,3)4)14-10-9-11-15(22)17(14)18/h7-13,18-19H,5-6H2,1-4H3/q+1/t18-,19+/m1/s1 |
| InChIKey | VSBDNMJNZDGYRX-MOPGFXCFSA-N |
| XLogP | 4.58 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|