C28H44N2O6 — CID 10051859
[(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate (PubChem CID 10051859) has the molecular formula C28H44N2O6 and a molecular weight of 504.67 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate.
| Compound Name | [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 10051859 |
| Molecular Formula | C28H44N2O6 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate |
| SMILES | CCCCCCCOC[C@@]12O[C@@H](CN3CCCCC3)[C@@H](OC(=O)Nc3ccccc3)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C28H44N2O6/c1-4-5-6-7-14-19-32-21-28-25(35-27(2,3)36-28)24(23(34-28)20-30-17-12-9-13-18-30)33-26(31)29-22-15-10-8-11-16-22/h8,10-11,15-16,23-25H,4-7,9,12-14,17-21H2,1-3H3,(H,29,31)/t23-,24+,25-,28-/m0/s1 |
| InChIKey | OZTUTJMBVZUUDX-GIBNYFNHSA-N |
| XLogP | 5.32 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|