C34H36N2O2 — CID 10051862
4-[7,7,10,10-tetramethyl-1-(2-pyridin-2-ylethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid (PubChem CID 10051862) has the molecular formula C34H36N2O2 and a molecular weight of 504.67 g/mol. Its IUPAC name is 4-[7,7,10,10-tetramethyl-1-(2-pyridin-2-ylethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid.
| Compound Name | 4-[7,7,10,10-tetramethyl-1-(2-pyridin-2-ylethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 10051862 |
| Molecular Formula | C34H36N2O2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 4-[7,7,10,10-tetramethyl-1-(2-pyridin-2-ylethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)CCc1c(-c2ccc(C(=O)O)cc2)cn(CCc2ccccn2)c1-3 |
| InChI | InChI=1S/C34H36N2O2/c1-33(2)15-16-34(3,4)30-20-27-24(19-29(30)33)12-13-26-28(22-8-10-23(11-9-22)32(37)38)21-36(31(26)27)18-14-25-7-5-6-17-35-25/h5-11,17,19-21H,12-16,18H2,1-4H3,(H,37,38) |
| InChIKey | IAJOHCKWOUDJLA-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |