C25H26FN3O5S — CID 100519754
2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 100519754) has the molecular formula C25H26FN3O5S and a molecular weight of 499.56 g/mol. Its IUPAC name is 2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 100519754 |
| Molecular Formula | C25H26FN3O5S |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(N3CCOCC3)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H26FN3O5S/c1-33-23-10-12-24(13-11-23)35(31,32)29(22-6-2-19(26)3-7-22)18-25(30)27-20-4-8-21(9-5-20)28-14-16-34-17-15-28/h2-13H,14-18H2,1H3,(H,27,30) |
| InChIKey | UPARIFWGAVIFIY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|