C24H39IO2Si — CID 10052187
(1R,2R,4R,11S)-4-[(Z,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-one (PubChem CID 10052187) has the molecular formula C24H39IO2Si and a molecular weight of 514.56 g/mol. Its IUPAC name is (1R,2R,4R,11S)-4-[(Z,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-one.
| Compound Name | (1R,2R,4R,11S)-4-[(Z,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-one |
|---|---|
| PubChem CID | 10052187 |
| Molecular Formula | C24H39IO2Si |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | (1R,2R,4R,11S)-4-[(Z,2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-one |
| SMILES | C/C(I)=C/C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1CCC2=CCC[C@]3(C)[C@H](C1=O)[C@H]23 |
| InChI | InChI=1S/C24H39IO2Si/c1-16(25)10-11-18(15-27-28(6,7)23(2,3)4)19-13-12-17-9-8-14-24(5)20(17)21(24)22(19)26/h9-10,18-21H,8,11-15H2,1-7H3/b16-10-/t18-,19-,20+,21+,24+/m1/s1 |
| InChIKey | ONMIWKKQELEXSH-QUBKRUSQSA-N |
| XLogP | 7.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|