C28H34N6O4 — CID 10052319
methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(1H-imidazol-5-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate (PubChem CID 10052319) has the molecular formula C28H34N6O4 and a molecular weight of 518.62 g/mol. Its IUPAC name is methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(1H-imidazol-5-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(1H-imidazol-5-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 10052319 |
| Molecular Formula | C28H34N6O4 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(1H-imidazol-5-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate |
| SMILES | CCCCc1ncc(/C=C2/C(=O)N(CCCC)C(=O)N2Cc2cnc[nH]2)n1Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C28H34N6O4/c1-4-6-8-25-30-16-23(33(25)17-20-9-11-21(12-10-20)27(36)38-3)14-24-26(35)32(13-7-5-2)28(37)34(24)18-22-15-29-19-31-22/h9-12,14-16,19H,4-8,13,17-18H2,1-3H3,(H,29,31)/b24-14- |
| InChIKey | LLTIWGZZYQICSH-OYKKKHCWSA-N |
| XLogP | 4.39 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|