C17H17Br2N3O4S — CID 10052340
3,5-dibromo-2-(butanoylamino)-N-(4-sulfamoylphenyl)benzamide (PubChem CID 10052340) has the molecular formula C17H17Br2N3O4S and a molecular weight of 519.22 g/mol. Its IUPAC name is 3,5-dibromo-2-(butanoylamino)-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 3,5-dibromo-2-(butanoylamino)-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 10052340 |
| Molecular Formula | C17H17Br2N3O4S |
| Molecular Weight | 519.22 g/mol |
| Exact Mass | 516.93 |
| IUPAC Name | 3,5-dibromo-2-(butanoylamino)-N-(4-sulfamoylphenyl)benzamide |
| SMILES | CCCC(=O)Nc1c(Br)cc(Br)cc1C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H17Br2N3O4S/c1-2-3-15(23)22-16-13(8-10(18)9-14(16)19)17(24)21-11-4-6-12(7-5-11)27(20,25)26/h4-9H,2-3H2,1H3,(H,21,24)(H,22,23)(H2,20,25,26) |
| InChIKey | JVQBZJLSFLWIBV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |