C27H37N3O4S — CID 100524187
(2R)-2-[benzyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide (PubChem CID 100524187) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is (2R)-2-[benzyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2R)-2-[benzyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100524187 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (2R)-2-[benzyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CN(c1ccccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C27H37N3O4S/c1-4-24(27(32)28-23-16-9-6-10-17-23)29(19-22-14-7-5-8-15-22)26(31)20-30(35(3,33)34)25-18-12-11-13-21(25)2/h5,7-8,11-15,18,23-24H,4,6,9-10,16-17,19-20H2,1-3H3,(H,28,32)/t24-/m1/s1 |
| InChIKey | OPNOOEHVICNNFA-XMMPIXPASA-N |
| XLogP | 4.02 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |