C28H40F3N2O4+ — CID 10052526
8-[5-methoxycarbonyl-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carbonyl]oxyoctyl-trimethylazanium (PubChem CID 10052526) has the molecular formula C28H40F3N2O4+ and a molecular weight of 525.63 g/mol. Its IUPAC name is 8-[5-methoxycarbonyl-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carbonyl]oxyoctyl-trimethylazanium.
| Compound Name | 8-[5-methoxycarbonyl-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carbonyl]oxyoctyl-trimethylazanium |
|---|---|
| PubChem CID | 10052526 |
| Molecular Formula | C28H40F3N2O4+ |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 8-[5-methoxycarbonyl-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carbonyl]oxyoctyl-trimethylazanium |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCCCC[N+](C)(C)C)C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H39F3N2O4/c1-19-23(26(34)36-6)25(21-15-11-12-16-22(21)28(29,30)31)24(20(2)32-19)27(35)37-18-14-10-8-7-9-13-17-33(3,4)5/h11-12,15-16,25H,7-10,13-14,17-18H2,1-6H3/p+1 |
| InChIKey | IEWMHZPNNRJVRZ-UHFFFAOYSA-O |
| XLogP | 5.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|