C16H16O2S — CID 100525281
(2S)-3-(3-methylphenyl)-2-phenylsulfanylpropanoic acid (PubChem CID 100525281) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is (2S)-3-(3-methylphenyl)-2-phenylsulfanylpropanoic acid.
| Compound Name | (2S)-3-(3-methylphenyl)-2-phenylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 100525281 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (2S)-3-(3-methylphenyl)-2-phenylsulfanylpropanoic acid |
| SMILES | Cc1cccc(C[C@H](Sc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C16H16O2S/c1-12-6-5-7-13(10-12)11-15(16(17)18)19-14-8-3-2-4-9-14/h2-10,15H,11H2,1H3,(H,17,18)/t15-/m0/s1 |
| InChIKey | YDBYLHWRFRVBIN-HNNXBMFYSA-N |
| XLogP | 3.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |