C26H33Cl2N3O4S — CID 100525392
(2S)-2-[benzyl-[2-(2,5-dichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide (PubChem CID 100525392) has the molecular formula C26H33Cl2N3O4S and a molecular weight of 554.54 g/mol. Its IUPAC name is (2S)-2-[benzyl-[2-(2,5-dichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[benzyl-[2-(2,5-dichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100525392 |
| Molecular Formula | C26H33Cl2N3O4S |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | (2S)-2-[benzyl-[2-(2,5-dichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CN(c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C26H33Cl2N3O4S/c1-3-23(26(33)29-21-12-8-5-9-13-21)30(17-19-10-6-4-7-11-19)25(32)18-31(36(2,34)35)24-16-20(27)14-15-22(24)28/h4,6-7,10-11,14-16,21,23H,3,5,8-9,12-13,17-18H2,1-2H3,(H,29,33)/t23-/m0/s1 |
| InChIKey | WYAPYZBURSKTOU-QHCPKHFHSA-N |
| XLogP | 5.02 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |