C33H41N3O6S — CID 100525696
(2S)-2-[benzyl-[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide (PubChem CID 100525696) has the molecular formula C33H41N3O6S and a molecular weight of 607.77 g/mol. Its IUPAC name is (2S)-2-[benzyl-[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[benzyl-[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100525696 |
| Molecular Formula | C33H41N3O6S |
| Molecular Weight | 607.77 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | (2S)-2-[benzyl-[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CN(c1ccccc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C33H41N3O6S/c1-4-29(33(38)34-26-16-10-6-11-17-26)35(23-25-14-8-5-9-15-25)32(37)24-36(27-18-12-7-13-19-27)43(39,40)28-20-21-30(41-2)31(22-28)42-3/h5,7-9,12-15,18-22,26,29H,4,6,10-11,16-17,23-24H2,1-3H3,(H,34,38)/t29-/m0/s1 |
| InChIKey | RXJWGOVLVKUEGJ-LJAQVGFWSA-N |
| XLogP | 5.16 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |