C18H16INO5 — CID 100525954
dimethyl 5-[(2-iodo-4-methylbenzoyl)amino]benzene-1,3-dicarboxylate (PubChem CID 100525954) has the molecular formula C18H16INO5 and a molecular weight of 453.23 g/mol. Its IUPAC name is dimethyl 5-[(2-iodo-4-methylbenzoyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(2-iodo-4-methylbenzoyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 100525954 |
| Molecular Formula | C18H16INO5 |
| Molecular Weight | 453.23 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | dimethyl 5-[(2-iodo-4-methylbenzoyl)amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccc(C)cc2I)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H16INO5/c1-10-4-5-14(15(19)6-10)16(21)20-13-8-11(17(22)24-2)7-12(9-13)18(23)25-3/h4-9H,1-3H3,(H,20,21) |
| InChIKey | MEAZOJGJFSKHJU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|