C28H38FN3O4S — CID 100526545
(2R)-2-[benzyl-[4-(4-fluoro-N-methylsulfonylanilino)butanoyl]amino]-N-cyclohexylbutanamide (PubChem CID 100526545) has the molecular formula C28H38FN3O4S and a molecular weight of 531.69 g/mol. Its IUPAC name is (2R)-2-[benzyl-[4-(4-fluoro-N-methylsulfonylanilino)butanoyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2R)-2-[benzyl-[4-(4-fluoro-N-methylsulfonylanilino)butanoyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100526545 |
| Molecular Formula | C28H38FN3O4S |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | (2R)-2-[benzyl-[4-(4-fluoro-N-methylsulfonylanilino)butanoyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CCCN(c1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C28H38FN3O4S/c1-3-26(28(34)30-24-13-8-5-9-14-24)31(21-22-11-6-4-7-12-22)27(33)15-10-20-32(37(2,35)36)25-18-16-23(29)17-19-25/h4,6-7,11-12,16-19,24,26H,3,5,8-10,13-15,20-21H2,1-2H3,(H,30,34)/t26-/m1/s1 |
| InChIKey | ZPXDBWYLTXHRFW-AREMUKBSSA-N |
| XLogP | 4.63 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |