C17H16INO — CID 100527033
(2-iodo-4-methylphenyl)-[(2R)-2-methyl-2,3-dihydroindol-1-yl]methanone (PubChem CID 100527033) has the molecular formula C17H16INO and a molecular weight of 377.23 g/mol. Its IUPAC name is (2-iodo-4-methylphenyl)-[(2R)-2-methyl-2,3-dihydroindol-1-yl]methanone.
| Compound Name | (2-iodo-4-methylphenyl)-[(2R)-2-methyl-2,3-dihydroindol-1-yl]methanone |
|---|---|
| PubChem CID | 100527033 |
| Molecular Formula | C17H16INO |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (2-iodo-4-methylphenyl)-[(2R)-2-methyl-2,3-dihydroindol-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2c3ccccc3C[C@H]2C)c(I)c1 |
| InChI | InChI=1S/C17H16INO/c1-11-7-8-14(15(18)9-11)17(20)19-12(2)10-13-5-3-4-6-16(13)19/h3-9,12H,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | MSINUOSBGPMENY-GFCCVEGCSA-N |
| XLogP | 4.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|