C30H47N3O5 — CID 10052707
(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-N-(2-pyridin-2-ylethyl)nonanamide (PubChem CID 10052707) has the molecular formula C30H47N3O5 and a molecular weight of 529.72 g/mol. Its IUPAC name is (2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-N-(2-pyridin-2-ylethyl)nonanamide.
| Compound Name | (2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-N-(2-pyridin-2-ylethyl)nonanamide |
|---|---|
| PubChem CID | 10052707 |
| Molecular Formula | C30H47N3O5 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.35 |
| IUPAC Name | (2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-N-(2-pyridin-2-ylethyl)nonanamide |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@@H](C)C(=O)NCCc2ccccn2)C(C)C)ccc1OC |
| InChI | InChI=1S/C30H47N3O5/c1-21(2)24(18-23-10-11-28(37-5)29(19-23)38-16-8-15-36-4)20-26(31)27(34)17-22(3)30(35)33-14-12-25-9-6-7-13-32-25/h6-7,9-11,13,19,21-22,24,26-27,34H,8,12,14-18,20,31H2,1-5H3,(H,33,35)/t22-,24+,26+,27+/m1/s1 |
| InChIKey | OOWLJDUZVJCLKH-LWGQKRLESA-N |
| XLogP | 3.78 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|