C28H28ClN7S — CID 10052714
5-[2-[4-[[3-[(4-chlorophenyl)methylsulfanyl]-5-pentyl-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 10052714) has the molecular formula C28H28ClN7S and a molecular weight of 530.10 g/mol. Its IUPAC name is 5-[2-[4-[[3-[(4-chlorophenyl)methylsulfanyl]-5-pentyl-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[[3-[(4-chlorophenyl)methylsulfanyl]-5-pentyl-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 10052714 |
| Molecular Formula | C28H28ClN7S |
| Molecular Weight | 530.10 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 5-[2-[4-[[3-[(4-chlorophenyl)methylsulfanyl]-5-pentyl-1,2,4-triazol-4-yl]methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CCCCCc1nnc(SCc2ccc(Cl)cc2)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H28ClN7S/c1-2-3-4-9-26-30-33-28(37-19-21-12-16-23(29)17-13-21)36(26)18-20-10-14-22(15-11-20)24-7-5-6-8-25(24)27-31-34-35-32-27/h5-8,10-17H,2-4,9,18-19H2,1H3,(H,31,32,34,35) |
| InChIKey | SYNROGAWDRKZBR-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.10 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|