C30H46O6Si — CID 10052739
(E,2R,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2,3-bis(phenylmethoxy)oct-6-en-4-ol (PubChem CID 10052739) has the molecular formula C30H46O6Si and a molecular weight of 530.78 g/mol. Its IUPAC name is (E,2R,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2,3-bis(phenylmethoxy)oct-6-en-4-ol.
| Compound Name | (E,2R,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2,3-bis(phenylmethoxy)oct-6-en-4-ol |
|---|---|
| PubChem CID | 10052739 |
| Molecular Formula | C30H46O6Si |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | (E,2R,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2,3-bis(phenylmethoxy)oct-6-en-4-ol |
| SMILES | C/C=C/[C@@H](OCOC)[C@@H](O)[C@H](OCc1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C30H46O6Si/c1-8-15-26(35-23-32-5)28(31)29(34-21-25-18-13-10-14-19-25)27(22-36-37(6,7)30(2,3)4)33-20-24-16-11-9-12-17-24/h8-19,26-29,31H,20-23H2,1-7H3/b15-8+/t26-,27-,28-,29-/m1/s1 |
| InChIKey | QVBNOJGSRVBDJV-BYGPQVOPSA-N |
| XLogP | 6.11 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|