C27H26F4N3O4+ — CID 10052790
[(10S)-10-ethyl-22,22,23,23-tetrafluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaen-19-yl]methyl-trimethylazanium (PubChem CID 10052790) has the molecular formula C27H26F4N3O4+ and a molecular weight of 532.51 g/mol. Its IUPAC name is [(10S)-10-ethyl-22,22,23,23-tetrafluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaen-19-yl]methyl-trimethylazanium.
| Compound Name | [(10S)-10-ethyl-22,22,23,23-tetrafluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaen-19-yl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 10052790 |
| Molecular Formula | C27H26F4N3O4+ |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | [(10S)-10-ethyl-22,22,23,23-tetrafluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaen-19-yl]methyl-trimethylazanium |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(C[N+](C)(C)C)c3c1c2C(F)(F)C(F)(F)C3 |
| InChI | InChI=1S/C27H26F4N3O4/c1-5-25(37)17-8-19-22-15(10-33(19)23(35)16(17)12-38-24(25)36)21-20-14(9-26(28,29)27(21,30)31)13(11-34(2,3)4)6-7-18(20)32-22/h6-8,37H,5,9-12H2,1-4H3/q+1/t25-/m0/s1 |
| InChIKey | ORDQKWDOGLQGPP-VWLOTQADSA-N |
| XLogP | 3.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|