C21H24INO2 — CID 100528468
2-iodo-4-methyl-N-[[4-(2-methylphenyl)oxan-4-yl]methyl]benzamide (PubChem CID 100528468) has the molecular formula C21H24INO2 and a molecular weight of 449.33 g/mol. Its IUPAC name is 2-iodo-4-methyl-N-[[4-(2-methylphenyl)oxan-4-yl]methyl]benzamide.
| Compound Name | 2-iodo-4-methyl-N-[[4-(2-methylphenyl)oxan-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 100528468 |
| Molecular Formula | C21H24INO2 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 2-iodo-4-methyl-N-[[4-(2-methylphenyl)oxan-4-yl]methyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC2(c3ccccc3C)CCOCC2)c(I)c1 |
| InChI | InChI=1S/C21H24INO2/c1-15-7-8-17(19(22)13-15)20(24)23-14-21(9-11-25-12-10-21)18-6-4-3-5-16(18)2/h3-8,13H,9-12,14H2,1-2H3,(H,23,24) |
| InChIKey | DJGXVAIKUOEGDX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|