C25H30ClFN2O2 — CID 100528617
(2R)-2-[benzyl-[2-(2-chloro-6-fluorophenyl)acetyl]amino]-N-cyclohexylbutanamide (PubChem CID 100528617) has the molecular formula C25H30ClFN2O2 and a molecular weight of 444.98 g/mol. Its IUPAC name is (2R)-2-[benzyl-[2-(2-chloro-6-fluorophenyl)acetyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2R)-2-[benzyl-[2-(2-chloro-6-fluorophenyl)acetyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100528617 |
| Molecular Formula | C25H30ClFN2O2 |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (2R)-2-[benzyl-[2-(2-chloro-6-fluorophenyl)acetyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C25H30ClFN2O2/c1-2-23(25(31)28-19-12-7-4-8-13-19)29(17-18-10-5-3-6-11-18)24(30)16-20-21(26)14-9-15-22(20)27/h3,5-6,9-11,14-15,19,23H,2,4,7-8,12-13,16-17H2,1H3,(H,28,31)/t23-/m1/s1 |
| InChIKey | HIUVHOWGDCNATF-HSZRJFAPSA-N |
| XLogP | 5.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |