C30H52O6Si — CID 10052907
methyl (3R)-7-[(1S,4aR,6S,8S,8aR)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate (PubChem CID 10052907) has the molecular formula C30H52O6Si and a molecular weight of 536.83 g/mol. Its IUPAC name is methyl (3R)-7-[(1S,4aR,6S,8S,8aR)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate.
| Compound Name | methyl (3R)-7-[(1S,4aR,6S,8S,8aR)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate |
|---|---|
| PubChem CID | 10052907 |
| Molecular Formula | C30H52O6Si |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | methyl (3R)-7-[(1S,4aR,6S,8S,8aR)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C[C@@H]2C=CC[C@H](CCC(=O)C[C@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C30H52O6Si/c1-10-21(3)29(33)35-26-17-20(2)16-23-13-11-12-22(28(23)26)14-15-24(31)18-25(19-27(32)34-7)36-37(8,9)30(4,5)6/h11,13,20-23,25-26,28H,10,12,14-19H2,1-9H3/t20-,21-,22+,23-,25+,26-,28+/m0/s1 |
| InChIKey | XOJDBZGCFIXPHZ-GWOUPALMSA-N |
| XLogP | 6.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|