C31H27F3N4O2 — CID 10053122
17-(5,5,5-trifluoropent-1-ynyl)-19-oxa-2,5,10,12-tetrazahexacyclo[18.6.2.22,5.114,18.08,12.023,27]hentriaconta-1(26),8,10,14(29),15,17,20(28),21,23(27),24-decaen-3-one (PubChem CID 10053122) has the molecular formula C31H27F3N4O2 and a molecular weight of 544.58 g/mol. Its IUPAC name is 17-(5,5,5-trifluoropent-1-ynyl)-19-oxa-2,5,10,12-tetrazahexacyclo[18.6.2.22,5.114,18.08,12.023,27]hentriaconta-1(26),8,10,14(29),15,17,20(28),21,23(27),24-decaen-3-one.
| Compound Name | 17-(5,5,5-trifluoropent-1-ynyl)-19-oxa-2,5,10,12-tetrazahexacyclo[18.6.2.22,5.114,18.08,12.023,27]hentriaconta-1(26),8,10,14(29),15,17,20(28),21,23(27),24-decaen-3-one |
|---|---|
| PubChem CID | 10053122 |
| Molecular Formula | C31H27F3N4O2 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 17-(5,5,5-trifluoropent-1-ynyl)-19-oxa-2,5,10,12-tetrazahexacyclo[18.6.2.22,5.114,18.08,12.023,27]hentriaconta-1(26),8,10,14(29),15,17,20(28),21,23(27),24-decaen-3-one |
| SMILES | O=C1CN2CCc3cncn3Cc3ccc(C#CCCC(F)(F)F)c(c3)Oc3ccc4cccc(c4c3)N1CC2 |
| InChI | InChI=1S/C31H27F3N4O2/c32-31(33,34)12-2-1-4-24-8-7-22-16-29(24)40-26-10-9-23-5-3-6-28(27(23)17-26)38-15-14-36(20-30(38)39)13-11-25-18-35-21-37(25)19-22/h3,5-10,16-18,21H,2,11-15,19-20H2 |
| InChIKey | HZUKRNKCJCVHQD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|