C30H29ClF3N3O2 — CID 10053419
1-(4-benzyl-4-hydroxypiperidin-1-yl)-3-[5-chloro-1-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]indol-3-yl]propan-1-one (PubChem CID 10053419) has the molecular formula C30H29ClF3N3O2 and a molecular weight of 556.03 g/mol. Its IUPAC name is 1-(4-benzyl-4-hydroxypiperidin-1-yl)-3-[5-chloro-1-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]indol-3-yl]propan-1-one.
| Compound Name | 1-(4-benzyl-4-hydroxypiperidin-1-yl)-3-[5-chloro-1-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]indol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 10053419 |
| Molecular Formula | C30H29ClF3N3O2 |
| Molecular Weight | 556.03 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 1-(4-benzyl-4-hydroxypiperidin-1-yl)-3-[5-chloro-1-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]indol-3-yl]propan-1-one |
| SMILES | Cn1c(-c2ccc(C(F)(F)F)cn2)c(CCC(=O)N2CCC(O)(Cc3ccccc3)CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C30H29ClF3N3O2/c1-36-26-11-8-22(31)17-24(26)23(28(36)25-10-7-21(19-35-25)30(32,33)34)9-12-27(38)37-15-13-29(39,14-16-37)18-20-5-3-2-4-6-20/h2-8,10-11,17,19,39H,9,12-16,18H2,1H3 |
| InChIKey | PEMJICDBBJDNIA-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.03 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|