C33H32F3N3O2 — CID 10053508
(3S,6S)-6-(4-aminobutyl)-3-(naphthalen-2-ylmethyl)-1-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazine-2,5-dione (PubChem CID 10053508) has the molecular formula C33H32F3N3O2 and a molecular weight of 559.63 g/mol. Its IUPAC name is (3S,6S)-6-(4-aminobutyl)-3-(naphthalen-2-ylmethyl)-1-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-6-(4-aminobutyl)-3-(naphthalen-2-ylmethyl)-1-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 10053508 |
| Molecular Formula | C33H32F3N3O2 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | (3S,6S)-6-(4-aminobutyl)-3-(naphthalen-2-ylmethyl)-1-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazine-2,5-dione |
| SMILES | NCCCC[C@H]1C(=O)N[C@@H](Cc2ccc3ccccc3c2)C(=O)N1Cc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C33H32F3N3O2/c34-33(35,36)28-16-14-26(15-17-28)25-11-8-22(9-12-25)21-39-30(7-3-4-18-37)31(40)38-29(32(39)41)20-23-10-13-24-5-1-2-6-27(24)19-23/h1-2,5-6,8-17,19,29-30H,3-4,7,18,20-21,37H2,(H,38,40)/t29-,30-/m0/s1 |
| InChIKey | PNUMXTNDBDZZKG-KYJUHHDHSA-N |
| XLogP | 6.09 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|