C22H27NO4 — CID 100535222
N-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3,4-diethoxybenzamide (PubChem CID 100535222) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3,4-diethoxybenzamide.
| Compound Name | N-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 100535222 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N[C@H]2CC(C)(C)Oc3ccccc32)cc1OCC |
| InChI | InChI=1S/C22H27NO4/c1-5-25-19-12-11-15(13-20(19)26-6-2)21(24)23-17-14-22(3,4)27-18-10-8-7-9-16(17)18/h7-13,17H,5-6,14H2,1-4H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | UURRBXHFATYLGT-KRWDZBQOSA-N |
| XLogP | 4.52 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |