C33H32Cl2IN3O4S — CID 100537218
(2S)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide (PubChem CID 100537218) has the molecular formula C33H32Cl2IN3O4S and a molecular weight of 764.51 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 100537218 |
| Molecular Formula | C33H32Cl2IN3O4S |
| Molecular Weight | 764.51 g/mol |
| Exact Mass | 763.05 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H32Cl2IN3O4S/c1-23(2)37-33(41)31(20-24-9-5-3-6-10-24)38(21-25-13-18-29(34)30(35)19-25)32(40)22-39(27-16-14-26(36)15-17-27)44(42,43)28-11-7-4-8-12-28/h3-19,23,31H,20-22H2,1-2H3,(H,37,41)/t31-/m0/s1 |
| InChIKey | LZANTCASYCSCEK-HKBQPEDESA-N |
| XLogP | 6.96 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.51 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|