C25H33ClN2O3 — CID 100537630
N-[(2S)-1-[[(2S)-butan-2-yl]amino]-1-oxopropan-2-yl]-4-(4-chlorophenoxy)-N-[(3-methylphenyl)methyl]butanamide (PubChem CID 100537630) has the molecular formula C25H33ClN2O3 and a molecular weight of 445.00 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-butan-2-yl]amino]-1-oxopropan-2-yl]-4-(4-chlorophenoxy)-N-[(3-methylphenyl)methyl]butanamide.
| Compound Name | N-[(2S)-1-[[(2S)-butan-2-yl]amino]-1-oxopropan-2-yl]-4-(4-chlorophenoxy)-N-[(3-methylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 100537630 |
| Molecular Formula | C25H33ClN2O3 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[(2S)-1-[[(2S)-butan-2-yl]amino]-1-oxopropan-2-yl]-4-(4-chlorophenoxy)-N-[(3-methylphenyl)methyl]butanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](C)N(Cc1cccc(C)c1)C(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H33ClN2O3/c1-5-19(3)27-25(30)20(4)28(17-21-9-6-8-18(2)16-21)24(29)10-7-15-31-23-13-11-22(26)12-14-23/h6,8-9,11-14,16,19-20H,5,7,10,15,17H2,1-4H3,(H,27,30)/t19-,20-/m0/s1 |
| InChIKey | UFSXNPMYOZNSSH-PMACEKPBSA-N |
| XLogP | 5.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|