C16H15IN2O4S2 — CID 100540988
N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-iodo-4-methoxybenzenesulfonamide (PubChem CID 100540988) has the molecular formula C16H15IN2O4S2 and a molecular weight of 490.34 g/mol. Its IUPAC name is N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-iodo-4-methoxybenzenesulfonamide.
| Compound Name | N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-iodo-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 100540988 |
| Molecular Formula | C16H15IN2O4S2 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.95 |
| IUPAC Name | N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-iodo-4-methoxybenzenesulfonamide |
| SMILES | CCn1c(=O)sc2cc(NS(=O)(=O)c3ccc(OC)c(I)c3)ccc21 |
| InChI | InChI=1S/C16H15IN2O4S2/c1-3-19-13-6-4-10(8-15(13)24-16(19)20)18-25(21,22)11-5-7-14(23-2)12(17)9-11/h4-9,18H,3H2,1-2H3 |
| InChIKey | AMELUUYBXOIGRW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|