C33H42N2O6S — CID 10054215
N-methyl-3-[4-(1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenoxy]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]propan-1-amine (PubChem CID 10054215) has the molecular formula C33H42N2O6S and a molecular weight of 594.77 g/mol. Its IUPAC name is N-methyl-3-[4-(1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenoxy]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]propan-1-amine.
| Compound Name | N-methyl-3-[4-(1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenoxy]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 10054215 |
| Molecular Formula | C33H42N2O6S |
| Molecular Weight | 594.77 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | N-methyl-3-[4-(1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenoxy]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]propan-1-amine |
| SMILES | COc1cc(CCN(C)CCCOc2ccc(S(=O)(=O)c3c(C(C)C)c4ccccc4n3C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C33H42N2O6S/c1-23(2)31-27-11-8-9-12-28(27)35(4)33(31)42(36,37)26-15-13-25(14-16-26)41-20-10-18-34(3)19-17-24-21-29(38-5)32(40-7)30(22-24)39-6/h8-9,11-16,21-23H,10,17-20H2,1-7H3 |
| InChIKey | UKLQRRVICLDJKJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.77 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|