C15H7F3N4O2S — CID 1005422
11-pyridin-4-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione (PubChem CID 1005422) has the molecular formula C15H7F3N4O2S and a molecular weight of 364.31 g/mol. Its IUPAC name is 11-pyridin-4-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione.
| Compound Name | 11-pyridin-4-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
|---|---|
| PubChem CID | 1005422 |
| Molecular Formula | C15H7F3N4O2S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 11-pyridin-4-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
| SMILES | O=c1[nH]c(=O)c2sc3nc(-c4ccncc4)cc(C(F)(F)F)c3c2[nH]1 |
| InChI | InChI=1S/C15H7F3N4O2S/c16-15(17,18)7-5-8(6-1-3-19-4-2-6)20-13-9(7)10-11(25-13)12(23)22-14(24)21-10/h1-5H,(H2,21,22,23,24) |
| InChIKey | VCIUQYHUODFWAR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |