C27H32O8SSe — CID 10054223
dimethyl 3-(2-methoxy-2-oxoethyl)-3-[(4-methylphenyl)sulfonylmethyl]-4-(phenylselanylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 10054223) has the molecular formula C27H32O8SSe and a molecular weight of 595.57 g/mol. Its IUPAC name is dimethyl 3-(2-methoxy-2-oxoethyl)-3-[(4-methylphenyl)sulfonylmethyl]-4-(phenylselanylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(2-methoxy-2-oxoethyl)-3-[(4-methylphenyl)sulfonylmethyl]-4-(phenylselanylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10054223 |
| Molecular Formula | C27H32O8SSe |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | dimethyl 3-(2-methoxy-2-oxoethyl)-3-[(4-methylphenyl)sulfonylmethyl]-4-(phenylselanylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)CC1(CS(=O)(=O)c2ccc(C)cc2)CC(C(=O)OC)(C(=O)OC)CC1C[Se]c1ccccc1 |
| InChI | InChI=1S/C27H32O8SSe/c1-19-10-12-21(13-11-19)36(31,32)18-26(15-23(28)33-2)17-27(24(29)34-3,25(30)35-4)14-20(26)16-37-22-8-6-5-7-9-22/h5-13,20H,14-18H2,1-4H3 |
| InChIKey | YSDQJOXGJUEULU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|