C34H34FN3O6 — CID 10054291
N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide (PubChem CID 10054291) has the molecular formula C34H34FN3O6 and a molecular weight of 599.66 g/mol. Its IUPAC name is N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 10054291 |
| Molecular Formula | C34H34FN3O6 |
| Molecular Weight | 599.66 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1cc(OCCCN(C)Cc2ccc(OC)c(OC)c2)ccc1NC(=O)c1cccc2c(=O)c3cccc(F)c3[nH]c12 |
| InChI | InChI=1S/C34H34FN3O6/c1-38(20-21-12-15-28(41-2)30(18-21)43-4)16-7-17-44-22-13-14-27(29(19-22)42-3)36-34(40)25-10-5-8-23-31(25)37-32-24(33(23)39)9-6-11-26(32)35/h5-6,8-15,18-19H,7,16-17,20H2,1-4H3,(H,36,40)(H,37,39) |
| InChIKey | ZCWJIRCDTQUXJH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|