C33H36N6O5S — CID 100544093
N-[2-methoxy-4-[(4R,5S)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide (PubChem CID 100544093) has the molecular formula C33H36N6O5S and a molecular weight of 628.76 g/mol. Its IUPAC name is N-[2-methoxy-4-[(4R,5S)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-methoxy-4-[(4R,5S)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100544093 |
| Molecular Formula | C33H36N6O5S |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | N-[2-methoxy-4-[(4R,5S)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(-n2c(C)cc([C@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(NC(=O)C(C)(C)C)c(OC)c3)c2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H36N6O5S/c1-19-16-23(20(2)37(19)26-14-12-22(43-6)18-27(26)39(41)42)30-29(25-10-8-9-15-34-25)36-32(45)38(30)21-11-13-24(28(17-21)44-7)35-31(40)33(3,4)5/h8-18,29-30H,1-7H3,(H,35,40)(H,36,45)/t29-,30-/m0/s1 |
| InChIKey | UMWMZTDFIDZVRE-KYJUHHDHSA-N |
| XLogP | 6.58 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|