C21H24N4O7S2 — CID 100546628
(2R)-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide (PubChem CID 100546628) has the molecular formula C21H24N4O7S2 and a molecular weight of 508.58 g/mol. Its IUPAC name is (2R)-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide.
| Compound Name | (2R)-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide |
|---|---|
| PubChem CID | 100546628 |
| Molecular Formula | C21H24N4O7S2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | (2R)-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide |
| SMILES | CC[C@H](C(=O)Nc1ccc2c(c1)sc(=O)n2CC)N(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C21H24N4O7S2/c1-5-15(20(26)22-13-7-9-16-19(11-13)33-21(27)23(16)6-2)24(34(4,30)31)17-12-14(25(28)29)8-10-18(17)32-3/h7-12,15H,5-6H2,1-4H3,(H,22,26)/t15-/m1/s1 |
| InChIKey | DVCUGZDIUGUUEP-OAHLLOKOSA-N |
| XLogP | 3.18 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|