C14H26N4O3S2 — CID 100547193
N-[5-[[(2R)-2-ethylhexyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 100547193) has the molecular formula C14H26N4O3S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-[5-[[(2R)-2-ethylhexyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-[[(2R)-2-ethylhexyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 100547193 |
| Molecular Formula | C14H26N4O3S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[5-[[(2R)-2-ethylhexyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | CCCC[C@@H](CC)CNS(=O)(=O)c1nnc(NC(=O)C(C)C)s1 |
| InChI | InChI=1S/C14H26N4O3S2/c1-5-7-8-11(6-2)9-15-23(20,21)14-18-17-13(22-14)16-12(19)10(3)4/h10-11,15H,5-9H2,1-4H3,(H,16,17,19)/t11-/m1/s1 |
| InChIKey | QTBBVCFNSKKHJG-LLVKDONJSA-N |
| XLogP | 2.63 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|