C40H54N4OS — CID 10054895
1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-[2,6-di(propan-2-yl)phenyl]-1-heptylurea (PubChem CID 10054895) has the molecular formula C40H54N4OS and a molecular weight of 638.97 g/mol. Its IUPAC name is 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-[2,6-di(propan-2-yl)phenyl]-1-heptylurea.
| Compound Name | 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-[2,6-di(propan-2-yl)phenyl]-1-heptylurea |
|---|---|
| PubChem CID | 10054895 |
| Molecular Formula | C40H54N4OS |
| Molecular Weight | 638.97 g/mol |
| Exact Mass | 638.40 |
| IUPAC Name | 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-[2,6-di(propan-2-yl)phenyl]-1-heptylurea |
| SMILES | CCCCCCCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C40H54N4OS/c1-6-7-8-9-17-27-44(40(45)43-38-34(30(2)3)25-20-26-35(38)31(4)5)28-18-12-19-29-46-39-41-36(32-21-13-10-14-22-32)37(42-39)33-23-15-11-16-24-33/h10-11,13-16,20-26,30-31H,6-9,12,17-19,27-29H2,1-5H3,(H,41,42)(H,43,45) |
| InChIKey | CSQPJRLYLSZMJR-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.97 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|