C22H28O3 — CID 100549023
(2S)-3-(4-butylphenyl)-2-(2-propan-2-ylphenoxy)propanoic acid (PubChem CID 100549023) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (2S)-3-(4-butylphenyl)-2-(2-propan-2-ylphenoxy)propanoic acid.
| Compound Name | (2S)-3-(4-butylphenyl)-2-(2-propan-2-ylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 100549023 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (2S)-3-(4-butylphenyl)-2-(2-propan-2-ylphenoxy)propanoic acid |
| SMILES | CCCCc1ccc(C[C@H](Oc2ccccc2C(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C22H28O3/c1-4-5-8-17-11-13-18(14-12-17)15-21(22(23)24)25-20-10-7-6-9-19(20)16(2)3/h6-7,9-14,16,21H,4-5,8,15H2,1-3H3,(H,23,24)/t21-/m0/s1 |
| InChIKey | KIIKMHIUKIYMTK-NRFANRHFSA-N |
| XLogP | 5.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |