C18H23NO3S — CID 100550950
4-methoxy-2,3-dimethyl-N-[(2R)-2-phenylpropyl]benzenesulfonamide (PubChem CID 100550950) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 4-methoxy-2,3-dimethyl-N-[(2R)-2-phenylpropyl]benzenesulfonamide.
| Compound Name | 4-methoxy-2,3-dimethyl-N-[(2R)-2-phenylpropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100550950 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-methoxy-2,3-dimethyl-N-[(2R)-2-phenylpropyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC[C@H](C)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C18H23NO3S/c1-13(16-8-6-5-7-9-16)12-19-23(20,21)18-11-10-17(22-4)14(2)15(18)3/h5-11,13,19H,12H2,1-4H3/t13-/m0/s1 |
| InChIKey | BBSJHQNMAYFJIG-ZDUSSCGKSA-N |
| XLogP | 3.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |