C37H60O3SiSn — CID 10055503
tert-butyl-diphenyl-[[(2R,3S)-3-[(Z)-3-tributylstannylprop-1-enoxy]oxan-2-yl]methoxy]silane (PubChem CID 10055503) has the molecular formula C37H60O3SiSn and a molecular weight of 699.68 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(2R,3S)-3-[(Z)-3-tributylstannylprop-1-enoxy]oxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(2R,3S)-3-[(Z)-3-tributylstannylprop-1-enoxy]oxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 10055503 |
| Molecular Formula | C37H60O3SiSn |
| Molecular Weight | 699.68 g/mol |
| Exact Mass | 700.33 |
| IUPAC Name | tert-butyl-diphenyl-[[(2R,3S)-3-[(Z)-3-tributylstannylprop-1-enoxy]oxan-2-yl]methoxy]silane |
| SMILES | CCCC[Sn](C/C=C\O[C@H]1CCCO[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C25H33O3Si.3C4H9.Sn/c1-5-18-26-23-17-12-19-27-24(23)20-28-29(25(2,3)4,21-13-8-6-9-14-21)22-15-10-7-11-16-22;3*1-3-4-2;/h5-11,13-16,18,23-24H,1,12,17,19-20H2,2-4H3;3*1,3-4H2,2H3;/b18-5-;;;;/t23-,24+;;;;/m0..../s1 |
| InChIKey | CFNSXPKDRKFAQQ-ZZJMUBJWSA-N |
| XLogP | 9.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.68 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|