C38H58O12 — CID 10055565
tritert-butyl (1R,3S,4S,5S,6R,7R)-4,6-dihydroxy-7-(2-methoxypropan-2-yloxy)-1-[(E)-5-methyl-6-phenylhex-3-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate (PubChem CID 10055565) has the molecular formula C38H58O12 and a molecular weight of 706.87 g/mol. Its IUPAC name is tritert-butyl (1R,3S,4S,5S,6R,7R)-4,6-dihydroxy-7-(2-methoxypropan-2-yloxy)-1-[(E)-5-methyl-6-phenylhex-3-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate.
| Compound Name | tritert-butyl (1R,3S,4S,5S,6R,7R)-4,6-dihydroxy-7-(2-methoxypropan-2-yloxy)-1-[(E)-5-methyl-6-phenylhex-3-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 10055565 |
| Molecular Formula | C38H58O12 |
| Molecular Weight | 706.87 g/mol |
| Exact Mass | 706.39 |
| IUPAC Name | tritert-butyl (1R,3S,4S,5S,6R,7R)-4,6-dihydroxy-7-(2-methoxypropan-2-yloxy)-1-[(E)-5-methyl-6-phenylhex-3-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
| SMILES | COC(C)(C)O[C@@H]1[C@@H](O)[C@]2(C(=O)OC(C)(C)C)O[C@@]1(CC/C=C/C(C)Cc1ccccc1)O[C@H](C(=O)OC(C)(C)C)[C@@]2(O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H58O12/c1-24(23-25-20-15-14-16-21-25)19-17-18-22-36-27(45-35(11,12)44-13)26(39)38(50-36,31(42)49-34(8,9)10)37(43,30(41)48-33(5,6)7)28(46-36)29(40)47-32(2,3)4/h14-17,19-21,24,26-28,39,43H,18,22-23H2,1-13H3/b19-17+/t24?,26-,27-,28-,36-,37-,38-/m1/s1 |
| InChIKey | XVWUUTZGCFTGMF-MCJSECEQSA-N |
| XLogP | 4.95 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|