C30H30ClN5OS — CID 100555829
N-[4-[(4R,5S)-5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide (PubChem CID 100555829) has the molecular formula C30H30ClN5OS and a molecular weight of 544.12 g/mol. Its IUPAC name is N-[4-[(4R,5S)-5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide.
| Compound Name | N-[4-[(4R,5S)-5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 100555829 |
| Molecular Formula | C30H30ClN5OS |
| Molecular Weight | 544.12 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | N-[4-[(4R,5S)-5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2cc(C)n(-c3ccc(Cl)cc3)c2C)cc1C |
| InChI | InChI=1S/C30H30ClN5OS/c1-5-27(37)33-25-14-13-23(16-18(25)2)36-29(28(34-30(36)38)26-8-6-7-15-32-26)24-17-19(3)35(20(24)4)22-11-9-21(31)10-12-22/h6-17,28-29H,5H2,1-4H3,(H,33,37)(H,34,38)/t28-,29-/m0/s1 |
| InChIKey | HMVFWNOXIFOHSD-VMPREFPWSA-N |
| XLogP | 6.98 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.12 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|