C28H21F16O2P — CID 10055686
bis(2,2,3,3,4,4,5,5-octafluoropentoxy)-triphenyl-λ5-phosphane (PubChem CID 10055686) has the molecular formula C28H21F16O2P and a molecular weight of 724.42 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,5,5-octafluoropentoxy)-triphenyl-λ5-phosphane.
| Compound Name | bis(2,2,3,3,4,4,5,5-octafluoropentoxy)-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 10055686 |
| Molecular Formula | C28H21F16O2P |
| Molecular Weight | 724.42 g/mol |
| Exact Mass | 724.10 |
| IUPAC Name | bis(2,2,3,3,4,4,5,5-octafluoropentoxy)-triphenyl-λ5-phosphane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COP(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H21F16O2P/c29-21(30)25(37,38)27(41,42)23(33,34)16-45-47(18-10-4-1-5-11-18,19-12-6-2-7-13-19,20-14-8-3-9-15-20)46-17-24(35,36)28(43,44)26(39,40)22(31)32/h1-15,21-22H,16-17H2 |
| InChIKey | HWLUVQBYESAVMV-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.42 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|