C25H27N3O6S — CID 100557386
2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(1S)-1-(4-methoxy-3-methylphenyl)propyl]acetamide (PubChem CID 100557386) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(1S)-1-(4-methoxy-3-methylphenyl)propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(1S)-1-(4-methoxy-3-methylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 100557386 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(1S)-1-(4-methoxy-3-methylphenyl)propyl]acetamide |
| SMILES | CC[C@H](NC(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C25H27N3O6S/c1-4-23(19-13-14-24(34-3)18(2)15-19)26-25(29)17-27(20-9-8-10-21(16-20)28(30)31)35(32,33)22-11-6-5-7-12-22/h5-16,23H,4,17H2,1-3H3,(H,26,29)/t23-/m0/s1 |
| InChIKey | WDHLZASFUBLSEI-QHCPKHFHSA-N |
| XLogP | 4.37 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|